EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@@]12CC=C3C(=CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@H](C)CC[C@H](O)[C@](C)(O)CO)[C@@]1(C)CCC(=O)C2(C)C |
| InChI | InChI=1S/C30H48O4/c1-19(8-11-25(33)30(7,34)18-31)20-12-16-29(6)22-9-10-23-26(2,3)24(32)14-15-27(23,4)21(22)13-17-28(20,29)5/h9,13,19-20,23,25,31,33-34H,8,10-12,14-18H2,1-7H3/t19-,20-,23+,25+,27-,28-,29+,30-/m1/s1 |
| InChIKey | KASALCUNLBTNAA-LIPCCPSCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | fruit body (BTO:0000487) | PubMed (22044278) | A methanol extract of the fruiting bodies |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ganodermanontriol (CHEBI:68858) has role metabolite (CHEBI:25212) |
| Ganodermanontriol (CHEBI:68858) is a triterpenoid (CHEBI:36615) |
| Synonym | Source |
|---|---|
| Lanosta-7,9(11)-dien-3-one, 24,25,26-trihydroxy-, (24S,25R)- | ChEBI |
| Citations |
|---|