EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C3H6O5P)n.HO |
| Net Charge | -2 |
| Average Mass | 170.057 |
| Monoisotopic Mass | 169.99912 |
| SMILES | [H]OCC(O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C3H9O6P/c4-1-3(5)2-9-10(6,7)8/h3-5H,1-2H2,(H2,6,7,8)/p-2 |
| InChIKey | AWUCVROLDVIAJX-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| poly(glycerol phosphate) anion (CHEBI:68851) has role bacterial metabolite (CHEBI:76969) |
| poly(glycerol phosphate) anion (CHEBI:68851) is a organophosphate oxoanion (CHEBI:58945) |
| poly(glycerol phosphate) anion (CHEBI:68851) is a polyanionic polymer (CHEBI:61469) |
| poly(glycerol phosphate) anion (CHEBI:68851) is conjugate base of poly(glycerol phosphate) macromolecule (CHEBI:15943) |
| Incoming Relation(s) |
| poly(glycerol phosphate) macromolecule (CHEBI:15943) is conjugate acid of poly(glycerol phosphate) anion (CHEBI:68851) |
| Synonyms | Source |
|---|---|
| (glycerophosphate(1−))n | ChEBI |
| (glycerophosphate)n | SUBMITTER |
| poly(glycerol phosphate(1−)) | SUBMITTER |