EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H23N4O8.K |
| Net Charge | 0 |
| Average Mass | 606.632 |
| Monoisotopic Mass | 606.11530 |
| SMILES | CCOc1nc2cccc(C(=O)OCc3oc(=O)oc3C)c2n1Cc1ccc(-c2ccccc2-c2noc(=O)[n-]2)cc1.[K+] |
| InChI | InChI=1S/C30H24N4O8.K/c1-3-38-28-31-23-10-6-9-22(27(35)39-16-24-17(2)40-30(37)41-24)25(23)34(28)15-18-11-13-19(14-12-18)20-7-4-5-8-21(20)26-32-29(36)42-33-26;/h4-14H,3,15-16H2,1-2H3,(H,32,33,36);/q;+1/p-1 |
| InChIKey | IHWFKDWIUSZLCJ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| Applications: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azilsartan kamedoxomil (CHEBI:68847) has part azilsartan medoxomil(1−) (CHEBI:68849) |
| azilsartan kamedoxomil (CHEBI:68847) has role angiotensin receptor antagonist (CHEBI:61016) |
| azilsartan kamedoxomil (CHEBI:68847) has role antihypertensive agent (CHEBI:35674) |
| azilsartan kamedoxomil (CHEBI:68847) has role prodrug (CHEBI:50266) |
| azilsartan kamedoxomil (CHEBI:68847) is a organic potassium salt (CHEBI:50394) |
| IUPAC Name |
|---|
| potassium 3-{4'-[(2-ethoxy-7-{[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]carbonyl}-1H-benzimidazol-1-yl)methyl]biphenyl-2-yl}-5-oxo-1,2,4-oxadiazol-4-ide |
| Synonym | Source |
|---|---|
| TAK-491 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Edarbi | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D08865 | KEGG DRUG |
| WO2012107814 | Patent |
| US2005187269 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12331024 | Reaxys |
| CAS:863031-24-7 | KEGG DRUG |