EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6884 - Methylmethionine sulfonium salt
| Formula | C6H14NO2S.Cl |
| Net Charge | 0 |
| Average Mass | 199.703 |
| Monoisotopic Mass | 199.04338 |
| SMILES | C[S+](C)CC[C@H](N)C(=O)O.[Cl-] |
| InChI | InChI=1S/C6H13NO2S.ClH/c1-10(2)4-3-5(7)6(8)9;/h5H,3-4,7H2,1-2H3;1H/t5-;/m0./s1 |
| InChIKey | MYGVPKMVGSXPCQ-JEDNCBNOSA-N |
| Roles Classification |
|---|
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methylmethionine sulfonium salt (CHEBI:6884) has role anti-ulcer drug (CHEBI:49201) |
| Methylmethionine sulfonium salt (CHEBI:6884) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Methiosulfonium chloride | ChEMBL |
| methylmethionine sulfonium chloride | ChEMBL |
| Methylmethionine sulfonium chloride | KEGG COMPOUND |
| Methylmethionine sulfonium salt | KEGG COMPOUND |
| S-methylmethionine l-form chloride | ChEMBL |
| Vitamin U | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Ardesyl | ChEMBL |
| Cabagin | ChEMBL |
| Cabagin u | ChEMBL |
| Epadyn u | ChEMBL |
| Merastom | ChEMBL |
| U-vit | ChEMBL |
| Citations |
|---|