EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O6 |
| Net Charge | 0 |
| Average Mass | 300.266 |
| Monoisotopic Mass | 300.06339 |
| SMILES | COc1cc(O)c2c(c1)C(=O)c1c(O)c(C)cc(O)c1C2=O |
| InChI | InChI=1S/C16H12O6/c1-6-3-9(17)12-13(14(6)19)15(20)8-4-7(22-2)5-10(18)11(8)16(12)21/h3-5,17-19H,1-2H3 |
| InChIKey | VUUONEBXXLQCQX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (17125234) |
| Roles Classification |
|---|
| Biological Roles: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erythroglaucin (CHEBI:68790) has role Chaetomium metabolite (CHEBI:76960) |
| erythroglaucin (CHEBI:68790) has role fungal metabolite (CHEBI:76946) |
| erythroglaucin (CHEBI:68790) is a aromatic ether (CHEBI:35618) |
| erythroglaucin (CHEBI:68790) is a trihydroxyanthraquinone (CHEBI:37488) |
| IUPAC Name |
|---|
| 1,4,5-trihydroxy-7-methoxy-2-methylanthracene-9,10-dione |
| Synonym | Source |
|---|---|
| Erythroglaucine | ChemIDplus |
| Citations |
|---|