EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | C/C=C/CCCCc1c(O)cc(CC=C(C)C)c(O)c1C=O |
| InChI | InChI=1S/C19H26O3/c1-4-5-6-7-8-9-16-17(13-20)19(22)15(12-18(16)21)11-10-14(2)3/h4-5,10,12-13,21-22H,6-9,11H2,1-3H3/b5-4+ |
| InChIKey | HBLOFOWPCVDNCG-SNAWJCMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (17125234) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isotetrahydroauroglaucin (CHEBI:68789) has role Chaetomium metabolite (CHEBI:76960) |
| isotetrahydroauroglaucin (CHEBI:68789) has role fungal metabolite (CHEBI:76946) |
| isotetrahydroauroglaucin (CHEBI:68789) has role radical scavenger (CHEBI:48578) |
| isotetrahydroauroglaucin (CHEBI:68789) is a benzaldehydes (CHEBI:22698) |
| isotetrahydroauroglaucin (CHEBI:68789) is a hydroquinones (CHEBI:24646) |
| IUPAC Name |
|---|
| 2-[(5E)-hept-5-en-1-yl]-3,6-dihydroxy-5-(3-methylbut-2-en-1-yl)benzaldehyde |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5565281 | Reaxys |
| Citations |
|---|