EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O4 |
| Net Charge | 0 |
| Average Mass | 316.397 |
| Monoisotopic Mass | 316.16746 |
| SMILES | [H]C(=O)c1c(O)c(CC=C(C)C)cc2c1CCC(/C=C/C(C)O)O2 |
| InChI | InChI=1S/C19H24O4/c1-12(2)4-6-14-10-18-16(17(11-20)19(14)22)9-8-15(23-18)7-5-13(3)21/h4-5,7,10-11,13,15,21-22H,6,8-9H2,1-3H3/b7-5+ |
| InChIKey | XWZLFKLXNARMNW-FNORWQNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (17125234) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetopyranin (CHEBI:68788) has role Chaetomium metabolite (CHEBI:76960) |
| chaetopyranin (CHEBI:68788) has role radical scavenger (CHEBI:48578) |
| chaetopyranin (CHEBI:68788) is a aldehyde (CHEBI:17478) |
| chaetopyranin (CHEBI:68788) is a chromenol (CHEBI:39436) |
| IUPAC Name |
|---|
| 6-hydroxy-2-[(1E)-3-hydroxybut-1-en-1-yl]-7-(3-methylbut-2-en-1-yl)-3,4-dihydro-2H-chromene-5-carbaldehyde |
| Manual Xrefs | Databases |
|---|---|
| 10167287 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19422229 | Reaxys |
| Citations |
|---|