EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26O7 |
| Net Charge | 0 |
| Average Mass | 414.454 |
| Monoisotopic Mass | 414.16785 |
| SMILES | CC1=CC=C2/C=C/C(C)=C(/C)CC(C)C(=O)C(C(=O)O)C3(C)O/C(=C/1O2)C(O)=C3O |
| InChI | InChI=1S/C23H26O7/c1-11-6-8-15-9-7-12(2)19(29-15)20-18(25)21(26)23(5,30-20)16(22(27)28)17(24)14(4)10-13(11)3/h6-9,14,16,25-26H,10H2,1-5H3,(H,27,28)/b8-6+,13-11-,20-19- |
| InChIKey | PBKVAXUNUBEUPO-OSHWNDANSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (22112725) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetoglobosin L (CHEBI:68775) has role Chaetomium metabolite (CHEBI:76960) |
| chaetoglobosin L (CHEBI:68775) has role antifungal agent (CHEBI:35718) |
| chaetoglobosin L (CHEBI:68775) has role antineoplastic agent (CHEBI:35610) |
| chaetoglobosin L (CHEBI:68775) has role metabolite (CHEBI:25212) |
| chaetoglobosin L (CHEBI:68775) is a cyclic ether (CHEBI:37407) |
| chaetoglobosin L (CHEBI:68775) is a enol (CHEBI:33823) |
| chaetoglobosin L (CHEBI:68775) is a macrocycle (CHEBI:51026) |
| chaetoglobosin L (CHEBI:68775) is a oxo monocarboxylic acid (CHEBI:35871) |
| IUPAC Name |
|---|
| (10Z,12E)-3,4-dihydroxy-5,8,10,11,17-pentamethyl-7-oxo-18,19-dioxatricyclo[12.3.1.12,5]nonadeca-1,3,10,12,14,16-hexaene-6-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22559057 | Reaxys |
| Citations |
|---|