EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26O7 |
| Net Charge | 0 |
| Average Mass | 414.454 |
| Monoisotopic Mass | 414.16785 |
| SMILES | CC1=CC=C2/C=C/C(C)=C(/C)CC(C)C(=O)C(C(=O)O)C3(C)O/C(=C/1O2)C(O)=C3O |
| InChI | InChI=1S/C23H26O7/c1-11-6-8-15-9-7-12(2)19(29-15)20-18(25)21(26)23(5,30-20)16(22(27)28)17(24)14(4)10-13(11)3/h6-9,14,16,25-26H,10H2,1-5H3,(H,27,28)/b8-6+,13-11-,20-19- |
| InChIKey | PBKVAXUNUBEUPO-OSHWNDANSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (22112725) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetoglobosin L (CHEBI:68775) has role Chaetomium metabolite (CHEBI:76960) |
| chaetoglobosin L (CHEBI:68775) has role antifungal agent (CHEBI:35718) |
| chaetoglobosin L (CHEBI:68775) has role antineoplastic agent (CHEBI:35610) |
| chaetoglobosin L (CHEBI:68775) has role metabolite (CHEBI:25212) |
| chaetoglobosin L (CHEBI:68775) is a cyclic ether (CHEBI:37407) |
| chaetoglobosin L (CHEBI:68775) is a enol (CHEBI:33823) |
| chaetoglobosin L (CHEBI:68775) is a macrocycle (CHEBI:51026) |
| chaetoglobosin L (CHEBI:68775) is a oxo monocarboxylic acid (CHEBI:35871) |
| IUPAC Name |
|---|
| (10Z,12E)-3,4-dihydroxy-5,8,10,11,17-pentamethyl-7-oxo-18,19-dioxatricyclo[12.3.1.12,5]nonadeca-1,3,10,12,14,16-hexaene-6-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22559057 | Reaxys |
| Citations |
|---|