EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO3 |
| Net Charge | 0 |
| Average Mass | 183.207 |
| Monoisotopic Mass | 183.08954 |
| SMILES | CC[C@@H]1CNC(=O)/C(=C(\C)O)C1=O |
| InChI | InChI=1S/C9H13NO3/c1-3-6-4-10-9(13)7(5(2)11)8(6)12/h6,11H,3-4H2,1-2H3,(H,10,13)/b7-5+/t6-/m1/s1 |
| InChIKey | UDRDPXWHYDODIC-LUFONEFESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (20814854) |
| Roles Classification |
|---|
| Biological Role: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetoglocin D (CHEBI:68769) has role Chaetomium metabolite (CHEBI:76960) |
| chaetoglocin D (CHEBI:68769) is a piperidones (CHEBI:48589) |
| IUPAC Name |
|---|
| (3E,5R)-5-ethyl-3-(1-hydroxyethylidene)piperidine-2,4-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22515441 | Reaxys |
| Citations |
|---|