EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O5 |
| Net Charge | 0 |
| Average Mass | 226.228 |
| Monoisotopic Mass | 226.08412 |
| SMILES | C/C=C(\CO)c1oc(=O)cc(OC)c1CO |
| InChI | InChI=1S/C11H14O5/c1-3-7(5-12)11-8(6-13)9(15-2)4-10(14)16-11/h3-4,12-13H,5-6H2,1-2H3/b7-3+ |
| InChIKey | DGBMMVBFYMZWHX-XVNBXDOJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (20814854) |
| Roles Classification |
|---|
| Biological Roles: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetoglocin A (CHEBI:68766) has role Chaetomium metabolite (CHEBI:76960) |
| chaetoglocin A (CHEBI:68766) has role antibacterial agent (CHEBI:33282) |
| chaetoglocin A (CHEBI:68766) is a 2-pyranones (CHEBI:75885) |
| chaetoglocin A (CHEBI:68766) is a diol (CHEBI:23824) |
| IUPAC Name |
|---|
| 6-[(2E)-1-hydroxybut-2-en-2-yl]-5-(hydroxymethyl)-4-methoxy-2H-pyran-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22515443 | Reaxys |
| Citations |
|---|