EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27ClO7 |
| Net Charge | 0 |
| Average Mass | 450.915 |
| Monoisotopic Mass | 450.14453 |
| SMILES | [H]C12C3=COC(/C=C/C(C)C(C)O)=CC3=C(Cl)C(=O)C1(C)OC1(O)C(C)C(C)OC(=O)C12[H] |
| InChI | InChI=1S/C23H27ClO7/c1-10(12(3)25)6-7-14-8-15-16(9-29-14)17-18-21(27)30-13(4)11(2)23(18,28)31-22(17,5)20(26)19(15)24/h6-13,17-18,25,28H,1-5H3/b7-6+ |
| InChIKey | LNHWUFUMZSBRBY-VOTSOKGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | |||
| mycelium (BTO:0001436) | PubMed (21548578) | Endophytic fungus in leaves of Viguiera robusta, EtOAc extract of culture broth and mycelium | |
| - | PubMed (21854043) |
| Roles Classification |
|---|
| Biological Role: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetoviridin D (CHEBI:68744) has role Chaetomium metabolite (CHEBI:76960) |
| chaetoviridin D (CHEBI:68744) is a enone (CHEBI:51689) |
| chaetoviridin D (CHEBI:68744) is a lactol (CHEBI:38131) |
| chaetoviridin D (CHEBI:68744) is a organic heterotetracyclic compound (CHEBI:38163) |
| chaetoviridin D (CHEBI:68744) is a organochlorine compound (CHEBI:36683) |
| chaetoviridin D (CHEBI:68744) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 5-chloro-7a-hydroxy-3-[(1E)-4-hydroxy-3-methylpent-1-en-1-yl]-6a,8,9-trimethyl-6a,7a,8,9,11a,11b-hexahydro-6H,11H-pyrano[3',4':4,5]furo[2,3-h][2]benzopyran-6,11-dione |
| Citations |
|---|