EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N3O2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 455.511 |
| Monoisotopic Mass | 455.20564 |
| SMILES | O=C(O)/C=C\C(=O)O.[H][C@@]12Cc3cnc4cccc(c34)C1=C[C@@H](C(=O)N[C@@H](CC)CO)CN2C |
| InChI | InChI=1S/C20H25N3O2.C4H4O4/c1-3-14(11-24)22-20(25)13-7-16-15-5-4-6-17-19(15)12(9-21-17)8-18(16)23(2)10-13;5-3(6)1-2-4(7)8/h4-7,9,13-14,18,21,24H,3,8,10-11H2,1-2H3,(H,22,25);1-2H,(H,5,6)(H,7,8)/b;2-1-/t13-,14+,18-;/m1./s1 |
| InChIKey | NOFOWWRHEPHDCY-DAUURJMHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methylergonovine Maleate (CHEBI:6874) has role geroprotector (CHEBI:176497) |
| Methylergonovine Maleate (CHEBI:6874) is a ergoline alkaloid (CHEBI:60529) |
| Synonyms | Source |
|---|---|
| Methylergometrine maleate | KEGG COMPOUND |
| Methylergonovine maleate | KEGG COMPOUND |
| NSC-757104 | ChEMBL |
| Citations |
|---|