EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20O7 |
| Net Charge | 0 |
| Average Mass | 396.395 |
| Monoisotopic Mass | 396.12090 |
| SMILES | [H]C(=O)c1c(O)cc(C)c2c1Oc1cc(OC)c(C(=O)C=C(C)C)c(C)c1OC2=O |
| InChI | InChI=1S/C22H20O7/c1-10(2)6-15(25)19-12(4)20-17(8-16(19)27-5)28-21-13(9-23)14(24)7-11(3)18(21)22(26)29-20/h6-9,24H,1-5H3 |
| InChIKey | SEGGMMXRZJRNCN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium brasiliense (ncbitaxon:155871) | - | PubMed (19663417) |
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mollicellin L (CHEBI:68725) has role Chaetomium metabolite (CHEBI:76960) |
| mollicellin L (CHEBI:68725) has role antimalarial (CHEBI:38068) |
| mollicellin L (CHEBI:68725) has role antineoplastic agent (CHEBI:35610) |
| mollicellin L (CHEBI:68725) is a aldehyde (CHEBI:17478) |
| mollicellin L (CHEBI:68725) is a aromatic ether (CHEBI:35618) |
| mollicellin L (CHEBI:68725) is a aromatic ketone (CHEBI:76224) |
| mollicellin L (CHEBI:68725) is a depsidones (CHEBI:75939) |
| mollicellin L (CHEBI:68725) is a enone (CHEBI:51689) |
| mollicellin L (CHEBI:68725) is a organic heterotricyclic compound (CHEBI:26979) |
| mollicellin L (CHEBI:68725) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3-hydroxy-7-methoxy-1,9-dimethyl-8-(3-methylbut-2-enoyl)-11-oxo-11H-dibenzo[b,e][1,4]dioxepine-4-carbaldehyde |
| Manual Xrefs | Databases |
|---|---|
| 24654422 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19895964 | Reaxys |
| Citations |
|---|