EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O10 |
| Net Charge | 0 |
| Average Mass | 546.528 |
| Monoisotopic Mass | 546.15260 |
| SMILES | C[C@@H]1Oc2cc3c(-c4c(O)cc(O)c5c(O)c6c(cc45)O[C@H](C)[C@@H](C)C6=O)c(O)cc(O)c3c(O)c2C(=O)[C@@H]1C |
| InChI | InChI=1S/C30H26O10/c1-9-11(3)39-19-5-13-21(15(31)7-17(33)23(13)29(37)25(19)27(9)35)22-14-6-20-26(28(36)10(2)12(4)40-20)30(38)24(14)18(34)8-16(22)32/h5-12,31-34,37-38H,1-4H3/t9-,10-,11-,12+/m1/s1 |
| InChIKey | RHNVLFNWDGWACV-KKOKHZNYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium gracile (ncbitaxon:47794) | - | PubMed (3594673) |
| Roles Classification |
|---|
| Biological Role: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetochromin B (CHEBI:68719) has role Chaetomium metabolite (CHEBI:76960) |
| chaetochromin B (CHEBI:68719) is a benzochromenone (CHEBI:64986) |
| chaetochromin B (CHEBI:68719) is a biaryl (CHEBI:64459) |
| chaetochromin B (CHEBI:68719) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2R,2'S,3R,3'R)-5,5',6,6',8,8'-hexahydroxy-2,2',3,3'-tetramethyl-2,2',3,3'-tetrahydro-4H,4'H-9,9'-bibenzo[g]chromene-4,4'-dione |
| Manual Xrefs | Databases |
|---|---|
| 24672344 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5787639 | Reaxys |
| Citations |
|---|