EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8O6 |
| Net Charge | 0 |
| Average Mass | 272.212 |
| Monoisotopic Mass | 272.03209 |
| SMILES | O=C1c2cc(O)cc(O)c2C(=O)c2c(O)cc(O)cc21 |
| InChI | InChI=1S/C14H8O6/c15-5-1-7-11(9(17)3-5)14(20)12-8(13(7)19)2-6(16)4-10(12)18/h1-4,15-18H |
| InChIKey | NTGIIKCGBNGQAR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (16904330) | |
| Leptographium wageneri (ncbitaxon:155671) | - | CiteXplore (c6149) |
| Roles Classification |
|---|
| Biological Role: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,6,8-tetrahydroxyanthraquinone (CHEBI:68717) has role Chaetomium metabolite (CHEBI:76960) |
| 1,3,6,8-tetrahydroxyanthraquinone (CHEBI:68717) is a tetrahydroxyanthraquinone (CHEBI:37496) |
| IUPAC Name |
|---|
| 1,3,6,8-tetrahydroxy-9,10-anthraquinone |
| Synonym | Source |
|---|---|
| Rheoemodin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2284674 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2060119 | Reaxys |
| CAS:52940-12-2 | ChemIDplus |
| Citations |
|---|