EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O6 |
| Net Charge | 0 |
| Average Mass | 286.239 |
| Monoisotopic Mass | 286.04774 |
| SMILES | COC(=O)c1c(O)ccc2oc3cccc(O)c3c(=O)c12 |
| InChI | InChI=1S/C15H10O6/c1-20-15(19)12-8(17)5-6-10-13(12)14(18)11-7(16)3-2-4-9(11)21-10/h2-6,16-17H,1H3 |
| InChIKey | RHTSTEXCCXSDAD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (16904330) |
| Roles Classification |
|---|
| Biological Role: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyvertixanthone (CHEBI:68716) has role Chaetomium metabolite (CHEBI:76960) |
| 2-hydroxyvertixanthone (CHEBI:68716) is a aromatic ester (CHEBI:62732) |
| 2-hydroxyvertixanthone (CHEBI:68716) is a methyl ester (CHEBI:25248) |
| 2-hydroxyvertixanthone (CHEBI:68716) is a polyphenol (CHEBI:26195) |
| 2-hydroxyvertixanthone (CHEBI:68716) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| methyl 2,8-dihydroxy-9-oxo-9H-xanthene-1-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10570283 | Reaxys |
| Citations |
|---|