EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8O5 |
| Net Charge | 0 |
| Average Mass | 256.213 |
| Monoisotopic Mass | 256.03717 |
| SMILES | O=C(O)c1cccc2oc3cccc(O)c3c(=O)c12 |
| InChI | InChI=1S/C14H8O5/c15-8-4-2-6-10-12(8)13(16)11-7(14(17)18)3-1-5-9(11)19-10/h1-6,15H,(H,17,18) |
| InChIKey | QRODRMXJCCGNJF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (16904330) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| globosuxanthone D (CHEBI:68715) has role Chaetomium metabolite (CHEBI:76960) |
| globosuxanthone D (CHEBI:68715) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| globosuxanthone D (CHEBI:68715) is a phenols (CHEBI:33853) |
| globosuxanthone D (CHEBI:68715) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 8-hydroxy-9-oxo-9H-xanthene-1-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10560840 | Reaxys |
| Citations |
|---|