EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O5 |
| Net Charge | 0 |
| Average Mass | 258.229 |
| Monoisotopic Mass | 258.05282 |
| SMILES | COc1ccc2oc3cccc(O)c3c(=O)c2c1O |
| InChI | InChI=1S/C14H10O5/c1-18-10-6-5-9-12(13(10)16)14(17)11-7(15)3-2-4-8(11)19-9/h2-6,15-16H,1H3 |
| InChIKey | VBNCFORRCHBVEU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (16904330) |
| Roles Classification |
|---|
| Biological Role: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| globosuxanthone C (CHEBI:68714) has role Chaetomium metabolite (CHEBI:76960) |
| globosuxanthone C (CHEBI:68714) is a aromatic ether (CHEBI:35618) |
| globosuxanthone C (CHEBI:68714) is a polyphenol (CHEBI:26195) |
| globosuxanthone C (CHEBI:68714) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,8-dihydroxy-2-methoxy-9H-xanthen-9-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10560230 | Reaxys |
| Citations |
|---|