EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O8 |
| Net Charge | 0 |
| Average Mass | 336.296 |
| Monoisotopic Mass | 336.08452 |
| SMILES | COC(=O)[C@@]1(O)c2c(oc3cccc(O)c3c2=O)C[C@H](OC)[C@H]1O |
| InChI | InChI=1S/C16H16O8/c1-22-10-6-9-12(16(21,14(10)19)15(20)23-2)13(18)11-7(17)4-3-5-8(11)24-9/h3-5,10,14,17,19,21H,6H2,1-2H3/t10-,14+,16+/m0/s1 |
| InChIKey | DKCFLWCWQILBFZ-DRZCJDIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (16904330) |
| Roles Classification |
|---|
| Biological Role: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| globosuxanthone B (CHEBI:68713) has role Chaetomium metabolite (CHEBI:76960) |
| globosuxanthone B (CHEBI:68713) is a ether (CHEBI:25698) |
| globosuxanthone B (CHEBI:68713) is a methyl ester (CHEBI:25248) |
| globosuxanthone B (CHEBI:68713) is a phenols (CHEBI:33853) |
| globosuxanthone B (CHEBI:68713) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| rel-methyl (1R,2R,3S)-1,2,8-trihydroxy-3-methoxy-9-oxo-2,3,4,9-tetrahydro-1H-xanthene-1-carboxylate |
| Synonym | Source |
|---|---|
| 1R*,2R*,8-trihydroxy-3S*-methoxy-1,2,3,4-tetrahydroxanthenone-1-carboxylic acid ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10589697 | Reaxys |
| Citations |
|---|