EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O7 |
| Net Charge | 0 |
| Average Mass | 304.254 |
| Monoisotopic Mass | 304.05830 |
| SMILES | COC(=O)[C@@]1(O)c2c(oc3cccc(O)c3c2=O)C=C[C@H]1O |
| InChI | InChI=1S/C15H12O7/c1-21-14(19)15(20)10(17)6-5-9-12(15)13(18)11-7(16)3-2-4-8(11)22-9/h2-6,10,16-17,20H,1H3/t10-,15+/m1/s1 |
| InChIKey | HEFOWMGZUBJFBY-BMIGLBTASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (16904330) |
| Roles Classification |
|---|
| Biological Role: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| globosuxanthone A (CHEBI:68712) has role Chaetomium metabolite (CHEBI:76960) |
| globosuxanthone A (CHEBI:68712) has role antineoplastic agent (CHEBI:35610) |
| globosuxanthone A (CHEBI:68712) is a methyl ester (CHEBI:25248) |
| globosuxanthone A (CHEBI:68712) is a phenols (CHEBI:33853) |
| globosuxanthone A (CHEBI:68712) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| rel-methyl (1R,2R)-1,2,8-trihydroxy-9-oxo-2,9-dihydro-1H-xanthene-1-carboxylate |
| Synonym | Source |
|---|---|
| 1R*,2R*,8-trihydroxanthenone-1-carboxylic acid methyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 13174524 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10577630 | Reaxys |
| Citations |
|---|