EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O8 |
| Net Charge | 0 |
| Average Mass | 320.253 |
| Monoisotopic Mass | 320.05322 |
| SMILES | COC1OC(C)=Cc2oc3cc(O)c(O)c(C(=O)O)c3c(=O)c21 |
| InChI | InChI=1S/C15H12O8/c1-5-3-7-10(15(21-2)22-5)13(18)9-8(23-7)4-6(16)12(17)11(9)14(19)20/h3-4,15-17H,1-2H3,(H,19,20) |
| InChIKey | CBEPLTZXYMLBAP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium funicola (ncbitaxon:79816) | - | PubMed (12019104) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. EC 3.5.2.6 (beta-lactamase) inhibitor An EC 3.5.2.* (non-peptide cyclic amide C-N hydrolase) inhibitor that interferes with the action of β-lactamase (EC 3.5.2.6). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,8-dihydroxy-1-methoxy-3-methyl-10-oxo-1H,10H-pyrano[4,3-b]chromene-9-carboxylic acid (CHEBI:68710) has role Chaetomium metabolite (CHEBI:76960) |
| 7,8-dihydroxy-1-methoxy-3-methyl-10-oxo-1H,10H-pyrano[4,3-b]chromene-9-carboxylic acid (CHEBI:68710) has role EC 3.5.2.6 (β-lactamase) inhibitor (CHEBI:35625) |
| 7,8-dihydroxy-1-methoxy-3-methyl-10-oxo-1H,10H-pyrano[4,3-b]chromene-9-carboxylic acid (CHEBI:68710) is a catechols (CHEBI:33566) |
| 7,8-dihydroxy-1-methoxy-3-methyl-10-oxo-1H,10H-pyrano[4,3-b]chromene-9-carboxylic acid (CHEBI:68710) is a cyclic ether (CHEBI:37407) |
| 7,8-dihydroxy-1-methoxy-3-methyl-10-oxo-1H,10H-pyrano[4,3-b]chromene-9-carboxylic acid (CHEBI:68710) is a cyclic ketone (CHEBI:3992) |
| 7,8-dihydroxy-1-methoxy-3-methyl-10-oxo-1H,10H-pyrano[4,3-b]chromene-9-carboxylic acid (CHEBI:68710) is a monocarboxylic acid (CHEBI:25384) |
| 7,8-dihydroxy-1-methoxy-3-methyl-10-oxo-1H,10H-pyrano[4,3-b]chromene-9-carboxylic acid (CHEBI:68710) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| 7,8-dihydroxy-1-methoxy-3-methyl-10-oxo-1H,10H-pyrano[4,3-b]chromene-9-carboxylic acid |
| Synonym | Source |
|---|---|
| SB238569 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8059216 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9580812 | Reaxys |
| Citations |
|---|