EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O6 |
| Net Charge | 0 |
| Average Mass | 308.330 |
| Monoisotopic Mass | 308.12599 |
| SMILES | [H][C@]1(CC2Cc3cc(O)cc(O)c3C(=O)O2)CCC(O)[C@H](C)O1 |
| InChI | InChI=1S/C16H20O6/c1-8-13(18)3-2-11(21-8)7-12-5-9-4-10(17)6-14(19)15(9)16(20)22-12/h4,6,8,11-13,17-19H,2-3,5,7H2,1H3/t8-,11+,12?,13?/m0/s1 |
| InChIKey | IEOXNDOOKTVJRQ-DRBGTSAUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavus (ncbitaxon:5059) | - | PubMed (4207788) | |
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (17125234) |
| Roles Classification |
|---|
| Biological Roles: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5'-hydroxyasperentin (CHEBI:68704) has functional parent asperentin (CHEBI:68792) |
| 5'-hydroxyasperentin (CHEBI:68704) has role Aspergillus metabolite (CHEBI:76956) |
| 5'-hydroxyasperentin (CHEBI:68704) has role Chaetomium metabolite (CHEBI:76960) |
| 5'-hydroxyasperentin (CHEBI:68704) is a isocoumarins (CHEBI:38758) |
| 5'-hydroxyasperentin (CHEBI:68704) is a pyrans (CHEBI:26407) |
| 5'-hydroxyasperentin (CHEBI:68704) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 6,8-dihydroxy-3-{[(2R,6S)-5-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]methyl}-3,4-dihydro-1H-isochromen-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15811808 | Reaxys |
| Citations |
|---|