EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O5 |
| Net Charge | 0 |
| Average Mass | 306.358 |
| Monoisotopic Mass | 306.14672 |
| SMILES | [H][C@]1(CC2Cc3cc(O)cc(OC)c3C(=O)O2)CCC[C@H](C)O1 |
| InChI | InChI=1S/C17H22O5/c1-10-4-3-5-13(21-10)9-14-7-11-6-12(18)8-15(20-2)16(11)17(19)22-14/h6,8,10,13-14,18H,3-5,7,9H2,1-2H3/t10-,13+,14?/m0/s1 |
| InChIKey | COFDRZBGPVKKJQ-CMVMAMJTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (17125234) |
| Roles Classification |
|---|
| Biological Role: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asperentin-8-methyl ether (CHEBI:68703) has functional parent asperentin (CHEBI:68792) |
| asperentin-8-methyl ether (CHEBI:68703) has role Chaetomium metabolite (CHEBI:76960) |
| asperentin-8-methyl ether (CHEBI:68703) is a aromatic ether (CHEBI:35618) |
| asperentin-8-methyl ether (CHEBI:68703) is a isocoumarins (CHEBI:38758) |
| asperentin-8-methyl ether (CHEBI:68703) is a phenols (CHEBI:33853) |
| asperentin-8-methyl ether (CHEBI:68703) is a pyrans (CHEBI:26407) |
| IUPAC Name |
|---|
| 6-hydroxy-8-methoxy-3-{[(2R,6S)-6-methyltetrahydro-2H-pyran-2-yl]methyl}-3,4-dihydro-1H-isochromen-1-one |
| Synonyms | Source |
|---|---|
| cladosporin 8-O-methylether | ChEBI |
| asperentin 8-O-methylether | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8572589 | Reaxys |
| Citations |
|---|