EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O6 |
| Net Charge | 0 |
| Average Mass | 322.357 |
| Monoisotopic Mass | 322.14164 |
| SMILES | [H][C@]1(CC2Cc3cc(O)cc(OC)c3C(=O)O2)CCC(O)[C@H](C)O1 |
| InChI | InChI=1S/C17H22O6/c1-9-14(19)4-3-12(22-9)8-13-6-10-5-11(18)7-15(21-2)16(10)17(20)23-13/h5,7,9,12-14,18-19H,3-4,6,8H2,1-2H3/t9-,12+,13?,14?/m0/s1 |
| InChIKey | WGJKMUHOVVKNEQ-VFEZIHALSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (17125234) | |
| Aspergillus flavus (ncbitaxon:5059) | - | PubMed (4207788) |
| Roles Classification |
|---|
| Biological Roles: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5'-hydroxy-asperentin-8-O-methylether (CHEBI:68702) has functional parent asperentin (CHEBI:68792) |
| 5'-hydroxy-asperentin-8-O-methylether (CHEBI:68702) has role Aspergillus metabolite (CHEBI:76956) |
| 5'-hydroxy-asperentin-8-O-methylether (CHEBI:68702) has role Chaetomium metabolite (CHEBI:76960) |
| 5'-hydroxy-asperentin-8-O-methylether (CHEBI:68702) is a aromatic ether (CHEBI:35618) |
| 5'-hydroxy-asperentin-8-O-methylether (CHEBI:68702) is a isocoumarins (CHEBI:38758) |
| 5'-hydroxy-asperentin-8-O-methylether (CHEBI:68702) is a phenols (CHEBI:33853) |
| 5'-hydroxy-asperentin-8-O-methylether (CHEBI:68702) is a pyrans (CHEBI:26407) |
| IUPAC Name |
|---|
| 6-hydroxy-3-{[(2R,6S)-5-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]methyl}-8-methoxy-3,4-dihydro-1H-isochromen-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15811806 | Reaxys |
| Citations |
|---|