EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O3 |
| Net Charge | 0 |
| Average Mass | 298.382 |
| Monoisotopic Mass | 298.15689 |
| SMILES | [H]C(=O)c1c(O)c(CC=C(C)C)cc2oc(/C=C/CCC)cc12 |
| InChI | InChI=1S/C19H22O3/c1-4-5-6-7-15-11-16-17(12-20)19(21)14(9-8-13(2)3)10-18(16)22-15/h6-8,10-12,21H,4-5,9H2,1-3H3/b7-6+ |
| InChIKey | SBYYFNVKZGJIPR-VOTSOKGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eurotium repens (ncbitaxon:41409) | - | PubMed (21667972) | EtOAc extract of Lyophilized fungus which was homogenized with acetone |
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (17125234) | |
| Aspergillus cristatus (ncbitaxon:573508) | - | DOI (10.1021/acsomega.9b00593) | Strain: CB10006 |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-5-hydroxy-6-(3-methylbut-2-enyl)-2-(pent-1-enyl)benzofuran-4-carbaldehyde (CHEBI:68701) has role Aspergillus metabolite (CHEBI:76956) |
| (E)-5-hydroxy-6-(3-methylbut-2-enyl)-2-(pent-1-enyl)benzofuran-4-carbaldehyde (CHEBI:68701) has role Chaetomium metabolite (CHEBI:76960) |
| (E)-5-hydroxy-6-(3-methylbut-2-enyl)-2-(pent-1-enyl)benzofuran-4-carbaldehyde (CHEBI:68701) has role radical scavenger (CHEBI:48578) |
| (E)-5-hydroxy-6-(3-methylbut-2-enyl)-2-(pent-1-enyl)benzofuran-4-carbaldehyde (CHEBI:68701) is a 1-benzofurans (CHEBI:38830) |
| (E)-5-hydroxy-6-(3-methylbut-2-enyl)-2-(pent-1-enyl)benzofuran-4-carbaldehyde (CHEBI:68701) is a aldehyde (CHEBI:17478) |
| (E)-5-hydroxy-6-(3-methylbut-2-enyl)-2-(pent-1-enyl)benzofuran-4-carbaldehyde (CHEBI:68701) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 5-hydroxy-6-(3-methylbut-2-en-1-yl)-2-[(1E)-pent-1-en-1-yl]-1-benzofuran-4-carbaldehyde |
| Synonyms | Source |
|---|---|
| 5-hydroxy-6-(3-methylbut-2-enyl)-2-[(E)-pent-1-enyl]-1-benzofuran-4-carbaldehyde | ChEBI |
| 2-(2',3-epoxy-1',3'-heptadienyl)-6-hydroxy-5-(3-methyl-2-butenyl)benzaldehyde | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15811804 | Reaxys |
| CAS:916602-30-7 | PubChem Compound |
| Citations |
|---|