EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CC(C)(C)[C@]1([H])CC/C(C)=C/CCC2=C |
| InChI | InChI=1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h6,13-14H,2,5,7-10H2,1,3-4H3/b11-6+/t13-,14+/m0/s1 |
| InChIKey | NPNUFJAVOOONJE-QWAJQTJBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eucalyptus benthamii (ncbitaxon:1711175) | - | PubMed (23609164) | |
| Euryops arabicus (IPNI:207382-1) | aerial part (BTO:0001658) | PubMed (21694678) | |
| Vernonia albicans (IPNI:257761-1) | aerial part (BTO:0001658) | PubMed (25230512) |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-2-epi-β-caryophyllene (CHEBI:68667) has role volatile oil component (CHEBI:27311) |
| (E)-2-epi-β-caryophyllene (CHEBI:68667) is a ortho-fused bicyclic hydrocarbon (CHEBI:35428) |
| (E)-2-epi-β-caryophyllene (CHEBI:68667) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1R,4E,9R)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene |
| Synonyms | Source |
|---|---|
| 2-epi-(E)-β-caryophyllene | KEGG COMPOUND |
| 9-epi-caryophyllene | ChEBI |
| 9-epi-(E)-caryophyllene | ChEBI |
| 9-epi-β-caryophyllene | ChEBI |
| UniProt Name | Source |
|---|---|
| (E)-2-epi-β-caryophyllene | UniProt |
| Citations |
|---|