EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC1=C[C@]2(C)CCC[C@@]23[C@H](C)CC[C@@]13C |
| InChI | InChI=1S/C15H24/c1-11-6-9-14(4)12(2)10-13(3)7-5-8-15(11,13)14/h10-11H,5-9H2,1-4H3/t11-,13+,14+,15-/m1/s1 |
| InChIKey | SAOJPWFHRMUCFN-UQOMUDLDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Matricaria chamomilla var. recutita (ncbitaxon:127986) | - | PubMed (22682202) |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-α-isocomene (CHEBI:68666) has role plant metabolite (CHEBI:76924) |
| (−)-α-isocomene (CHEBI:68666) has role volatile oil component (CHEBI:27311) |
| (−)-α-isocomene (CHEBI:68666) is a carbotricyclic compound (CHEBI:38032) |
| (−)-α-isocomene (CHEBI:68666) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1R,3aS,5aS,8aR)-1,3a,4,5a-tetramethyl-1,2,3,3a,5a,6,7,8-octahydrocyclopenta[c]pentalene |
| Synonym | Source |
|---|---|
| (−)-isocomene | LIPID MAPS |
| UniProt Name | Source |
|---|---|
| (−)-α-isocomene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMPR0103760002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2249036 | Reaxys |
| Citations |
|---|