EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O3 |
| Net Charge | 0 |
| Average Mass | 250.338 |
| Monoisotopic Mass | 250.15689 |
| SMILES | [H][C@@]12CC[C@@H](C)[C@@]13CC(C)(C)[C@H](O)[C@@]3([H])C=C2C(=O)O |
| InChI | InChI=1S/C15H22O3/c1-8-4-5-10-9(13(17)18)6-11-12(16)14(2,3)7-15(8,10)11/h6,8,10-12,16H,4-5,7H2,1-3H3,(H,17,18)/t8-,10+,11-,12-,15+/m1/s1 |
| InChIKey | WBLTVUMJMJIOGQ-YCGCYHNXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentalenic acid (CHEBI:68665) has functional parent pentalenene (CHEBI:17251) |
| pentalenic acid (CHEBI:68665) has role metabolite (CHEBI:25212) |
| pentalenic acid (CHEBI:68665) is a 5-hydroxy monocarboxylic acid (CHEBI:37125) |
| pentalenic acid (CHEBI:68665) is a carbotricyclic compound (CHEBI:38032) |
| pentalenic acid (CHEBI:68665) is a sesquiterpenoid (CHEBI:26658) |
| pentalenic acid (CHEBI:68665) is conjugate acid of pentalenate (CHEBI:68649) |
| Incoming Relation(s) |
| pentalenate (CHEBI:68649) is conjugate base of pentalenic acid (CHEBI:68665) |
| Manual Xrefs | Databases |
|---|---|
| CPDMETA-13643 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5340920 | Reaxys |
| Citations |
|---|