EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@]12CC(C)=C3CC[C@]3(C)[C@@]1([H])CC(C)(C)C2 |
| InChI | InChI=1S/C15H24/c1-10-7-11-8-14(2,3)9-13(11)15(4)6-5-12(10)15/h11,13H,5-9H2,1-4H3/t11-,13+,15+/m1/s1 |
| InChIKey | FBSBGGJQVUYUDB-ZLDLUXBVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Armillaria gallica (ncbitaxon:47427) | mycelium (BTO:0001436) | PubMed (21148562) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Δ6-protoilludene (CHEBI:68655) has role fungal metabolite (CHEBI:76946) |
| Δ6-protoilludene (CHEBI:68655) is a carbotricyclic compound (CHEBI:38032) |
| Δ6-protoilludene (CHEBI:68655) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (4aS,7aS,7bR)-3,6,6,7b-tetramethyl-2,4,4a,5,6,7,7a,7b-octahydro-1H-cyclobuta[e]indene |
| Synonym | Source |
|---|---|
| 6-protoilludene | ChEBI |
| UniProt Name | Source |
|---|---|
| Δ6-protoilludene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4383202 | Reaxys |
| Citations |
|---|