EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30FO8P |
| Net Charge | 0 |
| Average Mass | 472.446 |
| Monoisotopic Mass | 472.16623 |
| SMILES | [H][C@@]12C[C@@H](C)[C@](O)(C(=O)COP(=O)(O)O)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C22H30FO8P/c1-12-8-16-15-5-4-13-9-14(24)6-7-19(13,2)21(15,23)17(25)10-20(16,3)22(12,27)18(26)11-31-32(28,29)30/h6-7,9,12,15-17,25,27H,4-5,8,10-11H2,1-3H3,(H2,28,29,30)/t12-,15+,16+,17+,19+,20+,21+,22+/m1/s1 |
| InChIKey | VQODGRNSFPNSQE-CXSFZGCWSA-N |
| Roles Classification |
|---|
| Biological Role: | glucocorticoid receptor agonist An agonist that selectively binds to and activates a glucocorticoid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dexamethasone phosphate (CHEBI:68637) has functional parent dexamethasone (CHEBI:41879) |
| dexamethasone phosphate (CHEBI:68637) has role glucocorticoid receptor agonist (CHEBI:63562) |
| dexamethasone phosphate (CHEBI:68637) is a 11β-hydroxy steroid (CHEBI:35346) |
| dexamethasone phosphate (CHEBI:68637) is a 17-hydroxy steroid (CHEBI:36838) |
| dexamethasone phosphate (CHEBI:68637) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| dexamethasone phosphate (CHEBI:68637) is a fluorinated steroid (CHEBI:50830) |
| dexamethasone phosphate (CHEBI:68637) is a steroid phosphate (CHEBI:36944) |
| dexamethasone phosphate (CHEBI:68637) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| dexamethasone phosphate (CHEBI:68637) is conjugate acid of dexamethasone phosphate(2−) (CHEBI:68638) |
| Incoming Relation(s) |
| dexamethasone phosphate(2−) (CHEBI:68638) is conjugate base of dexamethasone phosphate (CHEBI:68637) |
| IUPAC Name |
|---|
| (11β,16α)-9-fluoro-11,17-dihydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-yl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| Betnelan phosphate | ChemIDplus |
| Dexamethasone-21-dihydrogen-phosphate | ChemIDplus |
| Dexamethasone 21-orthophosphate | ChemIDplus |
| Hexadrol phosphate | ChemIDplus |
| Neodecadron | ChemIDplus |
| Citations |
|---|