EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29O8P |
| Net Charge | -2 |
| Average Mass | 440.429 |
| Monoisotopic Mass | 440.16110 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COP(=O)([O-])[O-])[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C21H31O8P/c1-19-7-5-13(22)9-12(19)3-4-14-15-6-8-21(25,17(24)11-29-30(26,27)28)20(15,2)10-16(23)18(14)19/h9,14-16,18,23,25H,3-8,10-11H2,1-2H3,(H2,26,27,28)/p-2/t14-,15-,16-,18+,19-,20-,21-/m0/s1 |
| InChIKey | BGSOJVFOEQLVMH-VWUMJDOOSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cortisol phosphate(2−) (CHEBI:68633) is a steroid phosphate oxoanion (CHEBI:68607) |
| cortisol phosphate(2−) (CHEBI:68633) is conjugate base of cortisol phosphate (CHEBI:68634) |
| Incoming Relation(s) |
| cortisol sodium phosphate (CHEBI:5781) has part cortisol phosphate(2−) (CHEBI:68633) |
| cortisol phosphate (CHEBI:68634) is conjugate acid of cortisol phosphate(2−) (CHEBI:68633) |
| IUPAC Name |
|---|
| (11β)-11,17-dihydroxy-3,20-dioxopregn-4-en-21-yl phosphate |
| Synonym | Source |
|---|---|
| cortisol phosphate anion | ChEBI |