EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H9N4O9S2 |
| Net Charge | -3 |
| Average Mass | 465.401 |
| Monoisotopic Mass | 464.98274 |
| SMILES | O=C([O-])C1=NN(c2ccc(S(=O)(=O)[O-])cc2)C(=O)C1/N=N/c1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C16H12N4O9S2/c21-15-13(18-17-9-1-5-11(6-2-9)30(24,25)26)14(16(22)23)19-20(15)10-3-7-12(8-4-10)31(27,28)29/h1-8,13H,(H,22,23)(H,24,25,26)(H,27,28,29)/p-3/b18-17+ |
| InChIKey | RFKITWRHKUYMRJ-ISLYRVAYSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tartrazine(3−) (CHEBI:68628) is a monocarboxylic acid anion (CHEBI:35757) |
| tartrazine(3−) (CHEBI:68628) is a organosulfonate oxoanion (CHEBI:33554) |
| tartrazine(3−) (CHEBI:68628) is conjugate base of tartrazine acid (CHEBI:68629) |
| Incoming Relation(s) |
| tartrazine (CHEBI:9405) has part tartrazine(3−) (CHEBI:68628) |
| tartrazine acid (CHEBI:68629) is conjugate acid of tartrazine(3−) (CHEBI:68628) |
| IUPAC Name |
|---|
| 5-oxo-1-(4-sulfonatophenyl)-4-[(E)-(4-sulfonatophenyl)diazenyl]-4,5-dihydro-1H-pyrazole-3-carboxylate |