EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | [H][C@@]12CC[C@@](C)(O)[C@H](C/C=C(/C)C=C)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H34O/c1-7-15(2)9-10-17-19(5)13-8-12-18(3,4)16(19)11-14-20(17,6)21/h7,9,16-17,21H,1,8,10-14H2,2-6H3/b15-9-/t16-,17+,19-,20+/m0/s1 |
| InChIKey | ZAZVCYBIABTSJR-SZAPHMHZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-abienol (CHEBI:68624) has role metabolite (CHEBI:25212) |
| cis-abienol (CHEBI:68624) is a labdane diterpenoid (CHEBI:36770) |
| cis-abienol (CHEBI:68624) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1R,2R,4aS,8aS)-2,5,5,8a-tetramethyl-1-[(2Z)-3-methylpenta-2,4-dien-1-yl]decahydronaphthalen-2-ol |
| Synonyms | Source |
|---|---|
| (12Z)-Abienol | ChemIDplus |
| (Z)-Abienol | ChemIDplus |
| (Z)-Labda-12,14-dien-8-ol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| cis-abienol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2052449 | Reaxys |
| CAS:17990-16-8 | ChemIDplus |
| Citations |
|---|