EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H45N5O5 |
| Net Charge | 0 |
| Average Mass | 519.687 |
| Monoisotopic Mass | 519.34207 |
| SMILES | [H][C@@]12[C@@H](C(=O)NC(CC3CCC3)C(=O)C(N)=O)N(C(=O)[C@@H](NC(=O)NC(C)(C)C)C(C)(C)C)C[C@]1([H])C2(C)C |
| InChI | InChI=1S/C27H45N5O5/c1-25(2,3)20(30-24(37)31-26(4,5)6)23(36)32-13-15-17(27(15,7)8)18(32)22(35)29-16(19(33)21(28)34)12-14-10-9-11-14/h14-18,20H,9-13H2,1-8H3,(H2,28,34)(H,29,35)(H2,30,31,37)/t15-,16?,17-,18-,20+/m0/s1 |
| InChIKey | LHHCSNFAOIFYRV-DOVBMPENSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. peptidomimetic A small protein-like chain designed to mimic a peptide. hepatitis C protease inhibitor An inhibitor of hepatitis C protease, an enzyme required for production of proteins needed for viral assembly. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| boceprevir (CHEBI:68621) has role antiviral drug (CHEBI:36044) |
| boceprevir (CHEBI:68621) has role hepatitis C protease inhibitor (CHEBI:64924) |
| boceprevir (CHEBI:68621) has role peptidomimetic (CHEBI:63175) |
| boceprevir (CHEBI:68621) is a tripeptide (CHEBI:47923) |
| boceprevir (CHEBI:68621) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| (1R,2S,5S)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-3-[N-(tert-butylcarbamoyl)-3-methyl-L-valyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| INN | Source |
|---|---|
| boceprevir | KEGG DRUG |
| Synonym | Source |
|---|---|
| SCH 503034 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Victrelis | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D08876 | KEGG DRUG |
| HU5 | PDBeChem |
| WO2010117936 | Patent |
| WO2008073282 | Patent |
| WO2008076316 | Patent |
| WO2008079216 | Patent |
| US2007149459 | Patent |
| WO2007092616 | Patent |
| US2007287664 | Patent |
| US2006276404 | Patent |
| US2007010431 | Patent |
| US2006276407 | Patent |
| US2006281688 | Patent |
| US2007021351 | Patent |
| US2006276406 | Patent |
| US2006275366 | Patent |
| US2006281689 | Patent |
| WO2006130553 | Patent |
| WO2006130688 | Patent |
| US2005249702 | Patent |
| Boceprevir | Wikipedia |
| 4172 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10502086 | Reaxys |
| CAS:394730-60-0 | KEGG DRUG |
| CAS:394730-60-0 | ChemIDplus |
| Citations |
|---|