EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H8Br2N2O9 |
| Net Charge | 0 |
| Average Mass | 580.097 |
| Monoisotopic Mass | 577.85965 |
| SMILES | O=C1OC2(c3ccccc31)c1cc([N+](=O)[O-])c(O)c(Br)c1Oc1c2cc([N+](=O)[O-])c(O)c1Br |
| InChI | InChI=1S/C20H8Br2N2O9/c21-13-15(25)11(23(28)29)5-9-17(13)32-18-10(6-12(24(30)31)16(26)14(18)22)20(9)8-4-2-1-3-7(8)19(27)33-20/h1-6,25-26H |
| InChIKey | ZBQZBWKNGDEDOA-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eosin b diphenol (CHEBI:68618) has functional parent fluorescein (lactone form) (CHEBI:31624) |
| eosin b diphenol (CHEBI:68618) is a C-nitro compound (CHEBI:35716) |
| eosin b diphenol (CHEBI:68618) is a 2-benzofurans (CHEBI:38831) |
| eosin b diphenol (CHEBI:68618) is a lactone (CHEBI:25000) |
| eosin b diphenol (CHEBI:68618) is a organobromine compound (CHEBI:37141) |
| eosin b diphenol (CHEBI:68618) is a oxaspiro compound (CHEBI:37948) |
| eosin b diphenol (CHEBI:68618) is a xanthenes (CHEBI:38835) |
| eosin b diphenol (CHEBI:68618) is conjugate acid of eosin b(2−) (CHEBI:68617) |
| Incoming Relation(s) |
| eosin b(2−) (CHEBI:68617) is conjugate base of eosin b diphenol (CHEBI:68618) |
| IUPAC Name |
|---|
| 4',5'-dibromo-3',6'-dihydroxy-2',7'-dinitro-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| Synonym | Source |
|---|---|
| 2,7-dinitro-4,5-dibromofluorescein | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:71813 | Reaxys |