EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11NO3 |
| Net Charge | 0 |
| Average Mass | 205.213 |
| Monoisotopic Mass | 205.07389 |
| SMILES | O=C(O)CNC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C11H11NO3/c13-10(12-8-11(14)15)7-6-9-4-2-1-3-5-9/h1-7H,8H2,(H,12,13)(H,14,15)/b7-6+ |
| InChIKey | YAADMLWHGMUGQL-VOTSOKGWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-cinnamoylglycine (CHEBI:68616) has role metabolite (CHEBI:25212) |
| N-cinnamoylglycine (CHEBI:68616) is a N-acylglycine (CHEBI:16180) |
| N-cinnamoylglycine (CHEBI:68616) is conjugate acid of N-cinnamoylglycinate (CHEBI:133605) |
| Incoming Relation(s) |
| N-cinnamoylglycinate (CHEBI:133605) is conjugate base of N-cinnamoylglycine (CHEBI:68616) |
| IUPAC Name |
|---|
| N-[(2E)-3-phenylprop-2-enoyl]glycine |
| Synonyms | Source |
|---|---|
| N-(1-oxo-3-phenyl-2-propenyl)-Glycine | ChemIDplus |
| N-Cinnamylglycine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011621 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3201590 | Reaxys |
| CAS:16534-24-0 | ChemIDplus |
| Citations |
|---|