EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H66O15S2 |
| Net Charge | 0 |
| Average Mass | 839.076 |
| Monoisotopic Mass | 838.38431 |
| SMILES | [H][C@]1([C@H](C)C(OC(=O)CCC)C(OC(=O)CCC)C(CC)C(C)C)[C@@H](O)[C@H](OC(C)=O)[C@@]2([H])[C@]3([H])CCC4C[C@H](OS(=O)(=O)O)[C@@H](OS(=O)(=O)O)C[C@]4(C)[C@@]3([H])CC[C@]12C |
| InChI | InChI=1S/C39H66O15S2/c1-10-13-30(41)51-35(36(25(12-3)21(4)5)52-31(42)14-11-2)22(6)32-34(43)37(50-23(7)40)33-26-16-15-24-19-28(53-55(44,45)46)29(54-56(47,48)49)20-39(24,9)27(26)17-18-38(32,33)8/h21-22,24-29,32-37,43H,10-20H2,1-9H3,(H,44,45,46)(H,47,48,49)/t22-,24?,25?,26+,27-,28-,29-,32-,33+,34+,35?,36?,37+,38+,39-/m0/s1 |
| InChIKey | QZCHAQYTIIGVHJ-HXIPBOOUSA-N |
| Roles Classification |
|---|
| Biological Roles: | HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clathsterol disulfonic acid (CHEBI:68598) has parent hydride stigmastane (CHEBI:26773) |
| clathsterol disulfonic acid (CHEBI:68598) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| clathsterol disulfonic acid (CHEBI:68598) has role metabolite (CHEBI:25212) |
| clathsterol disulfonic acid (CHEBI:68598) is a 16β-hydroxy steroid (CHEBI:17354) |
| clathsterol disulfonic acid (CHEBI:68598) is a acetate ester (CHEBI:47622) |
| clathsterol disulfonic acid (CHEBI:68598) is a butyrate ester (CHEBI:50477) |
| clathsterol disulfonic acid (CHEBI:68598) is a steroid sulfate (CHEBI:16158) |
| clathsterol disulfonic acid (CHEBI:68598) is conjugate acid of clathsterol(2−) (CHEBI:68597) |
| Incoming Relation(s) |
| clathsterol(2−) (CHEBI:68597) is conjugate base of clathsterol disulfonic acid (CHEBI:68598) |
| IUPAC Name |
|---|
| (2β,3α,15α,16β,24ξ)-15-(acetyloxy)-16-hydroxy-2,3-bis(sulfooxy)stigmastane-22,23-diyl dibutanoate |