EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H53N7O6 |
| Net Charge | 0 |
| Average Mass | 679.863 |
| Monoisotopic Mass | 679.40573 |
| SMILES | [H][C@@]12CCC[C@]1([H])[C@@H](C(=O)N[C@@H](CCC)C(=O)C(=O)NC1CC1)N(C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(C)(C)C)C2 |
| InChI | InChI=1S/C36H53N7O6/c1-5-10-25(29(44)34(48)39-23-15-16-23)40-33(47)28-24-14-9-13-22(24)20-43(28)35(49)30(36(2,3)4)42-32(46)27(21-11-7-6-8-12-21)41-31(45)26-19-37-17-18-38-26/h17-19,21-25,27-28,30H,5-16,20H2,1-4H3,(H,39,48)(H,40,47)(H,41,45)(H,42,46)/t22-,24-,25-,27-,28-,30+/m0/s1 |
| InChIKey | BBAWEDCPNXPBQM-GDEBMMAJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | peptidomimetic A small protein-like chain designed to mimic a peptide. hepatitis C protease inhibitor An inhibitor of hepatitis C protease, an enzyme required for production of proteins needed for viral assembly. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| telaprevir (CHEBI:68595) has role antiviral drug (CHEBI:36044) |
| telaprevir (CHEBI:68595) has role hepatitis C protease inhibitor (CHEBI:64924) |
| telaprevir (CHEBI:68595) has role peptidomimetic (CHEBI:63175) |
| telaprevir (CHEBI:68595) is a cyclopentapyrrole (CHEBI:38296) |
| telaprevir (CHEBI:68595) is a cyclopropanes (CHEBI:51454) |
| telaprevir (CHEBI:68595) is a oligopeptide (CHEBI:25676) |
| telaprevir (CHEBI:68595) is a pyrazines (CHEBI:38314) |
| IUPAC Name |
|---|
| (1S,3aR,6aS)-2-[(2S)-2-({(2S)-2-cyclohexyl-2-[(pyrazin-2-ylcarbonyl)amino]acetyl}amino)-3,3-dimethylbutanoyl]-N-[(3S)-1-(cyclopropylamino)-1,2-dioxohexan-3-yl]octahydrocyclopenta[c]pyrrole-1-carboxamide |
| Synonyms | Source |
|---|---|
| (1S,3aR,6aS)-(2S)-2-cyclohexyl-N-(pyrazinylcarbonyl)glycyl-3-methyl-L-valyl-N-((1S)-1-((cyclopropylamino)oxoacetyl)butyl)octahydrocyclopenta(c)pyrrole-1-carboxamide | ChemIDplus |
| VX 950 | ChemIDplus |
| VX-950 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Incivek | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D09012 | KEGG DRUG |
| WO2011103932 | Patent |
| US2007087973 | Patent |
| WO2006127289 | Patent |
| US2005197301 | Patent |
| WO2005025517 | Patent |
| US2006252698 | Patent |
| US2006276407 | Patent |
| US2006276405 | Patent |
| US2006281688 | Patent |
| HMDB0015616 | HMDB |
| Telaprevir | Wikipedia |
| 4173 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10511882 | Reaxys |
| CAS:402957-28-2 | ChemIDplus |
| CAS:402957-28-2 | KEGG DRUG |
| Citations |
|---|