EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C52H74Cl2O18 |
| Net Charge | 0 |
| Average Mass | 1058.052 |
| Monoisotopic Mass | 1056.42522 |
| SMILES | CCc1c(Cl)c(O)c(Cl)c(O)c1C(=O)O[C@H]1[C@H](O)[C@H](OC)[C@H](OC/C2=C\C=C\C[C@H](O)/C(C)=C/[C@H](CC)[C@@H](O[C@@H]3OC(C)(C)[C@@H](OC(=O)C(C)C)[C@H](O)[C@@H]3O)/C(C)=C/C(C)=C/CC([C@@H](C)O)OC2=O)O[C@@H]1C |
| InChI | InChI=1S/C52H74Cl2O18/c1-13-30-22-26(6)33(56)18-16-15-17-31(23-66-51-45(65-12)42(61)44(29(9)67-51)69-49(64)35-32(14-2)36(53)39(58)37(54)38(35)57)48(63)68-34(28(8)55)20-19-25(5)21-27(7)43(30)70-50-41(60)40(59)46(52(10,11)72-50)71-47(62)24(3)4/h15-17,19,21-22,24,28-30,33-34,40-46,50-51,55-61H,13-14,18,20,23H2,1-12H3/b16-15+,25-19+,26-22+,27-21+,31-17+/t28-,29-,30+,33+,34?,40-,41+,42+,43+,44-,45+,46+,50-,51-/m1/s1 |
| InChIKey | ZVGNESXIJDCBKN-KFGPIHIUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 2.7.7.6 (RNA polymerase) inhibitor An EC 2.7.7.* (nucleotidyltransferase) inhibitor that interferes with the action of RNA polymerase (EC 2.7.7.6). antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fidaxomicin (CHEBI:68590) has role antibacterial drug (CHEBI:36047) |
| fidaxomicin (CHEBI:68590) has role bacterial metabolite (CHEBI:76969) |
| fidaxomicin (CHEBI:68590) has role EC 2.7.7.6 (RNA polymerase) inhibitor (CHEBI:37416) |
| fidaxomicin (CHEBI:68590) is a carboxylic ester (CHEBI:33308) |
| fidaxomicin (CHEBI:68590) is a glycoside (CHEBI:24400) |
| fidaxomicin (CHEBI:68590) is a macrolide antibiotic (CHEBI:25105) |
| fidaxomicin (CHEBI:68590) is a organochlorine compound (CHEBI:36683) |
| fidaxomicin (CHEBI:68590) is a phenols (CHEBI:33853) |
| Synonyms | Source |
|---|---|
| Lipiarmicin | ChemIDplus |
| Lipiarmycin | ChemIDplus |
| OPT 80 | ChemIDplus |
| OPT-80 | ChemIDplus |
| PAR 101 | ChemIDplus |
| PAR-101 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Dificid | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D09394 | KEGG DRUG |
| Fidaxomicin | Wikipedia |
| US2008269145 | Patent |
| WO2006085838 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12687773 | Reaxys |
| CAS:873857-62-6 | ChemIDplus |
| Citations |
|---|