EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18FN3O2 |
| Net Charge | 0 |
| Average Mass | 303.337 |
| Monoisotopic Mass | 303.13831 |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccc(F)cc2)cc1N |
| InChI | InChI=1S/C16H18FN3O2/c1-2-22-16(21)20-15-8-7-13(9-14(15)18)19-10-11-3-5-12(17)6-4-11/h3-9,19H,2,10,18H2,1H3,(H,20,21) |
| InChIKey | PCOBBVZJEWWZFR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ezogabine (CHEBI:68584) has functional parent benzene-1,2,4-triamine (CHEBI:29148) |
| ezogabine (CHEBI:68584) has role anticonvulsant (CHEBI:35623) |
| ezogabine (CHEBI:68584) has role potassium channel modulator (CHEBI:50510) |
| ezogabine (CHEBI:68584) is a carbamate ester (CHEBI:23003) |
| ezogabine (CHEBI:68584) is a organofluorine compound (CHEBI:37143) |
| ezogabine (CHEBI:68584) is a secondary amino compound (CHEBI:50995) |
| ezogabine (CHEBI:68584) is a substituted aniline (CHEBI:48975) |
| INN | Source |
|---|---|
| retigabine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| N-(2-Amino-4-(4-fluorobenzylamino)-phenyl) carbamic acid ethyl ester | KEGG COMPOUND |
| Ethyl 2-amino-4-((p-fluorobenzyl)amino)carbanilate | ChemIDplus |
| N-(2-Amino-4-(4-fluorobenzylamino)phenyl)carbamic acid ethyl ester | ChemIDplus |
| D-23129 | ChemIDplus |
| ethyl {2-amino-4-[(4-fluorobenzyl)amino]phenyl}carbamate | ChEBI |
| D-23129 | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Potiga | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D09569 | KEGG DRUG |
| C13826 | KEGG COMPOUND |
| WO2011012659 | Patent |
| US5384330 | Patent |
| US2002015730 | Patent |
| US2012053238 | Patent |
| WO2007090409 | Patent |
| US2002111379 | Patent |
| US6348486 | Patent |
| US2002183395 | Patent |
| Ezogabine | Wikipedia |
| 4181 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8072099 | Reaxys |
| CAS:150812-12-7 | KEGG COMPOUND |
| CAS:150812-12-7 | ChemIDplus |
| Citations |
|---|