EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18ClN3O5S |
| Net Charge | 0 |
| Average Mass | 435.889 |
| Monoisotopic Mass | 435.06557 |
| SMILES | O=C(NC[C@H]1CN(c2ccc(N3CCOCC3=O)cc2)C(=O)O1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H18ClN3O5S/c20-16-6-5-15(29-16)18(25)21-9-14-10-23(19(26)28-14)13-3-1-12(2-4-13)22-7-8-27-11-17(22)24/h1-6,14H,7-11H2,(H,21,25)/t14-/m0/s1 |
| InChIKey | KGFYHTZWPPHNLQ-AWEZNQCLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.4.21.6 (coagulation factor Xa) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of coagulation factor Xa (EC 3.4.21.6). |
| Application: | anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rivaroxaban (CHEBI:68579) has role anticoagulant (CHEBI:50249) |
| rivaroxaban (CHEBI:68579) has role EC 3.4.21.6 (coagulation factor Xa) inhibitor (CHEBI:68581) |
| rivaroxaban (CHEBI:68579) is a aromatic amide (CHEBI:62733) |
| rivaroxaban (CHEBI:68579) is a lactam (CHEBI:24995) |
| rivaroxaban (CHEBI:68579) is a monocarboxylic acid amide (CHEBI:29347) |
| rivaroxaban (CHEBI:68579) is a morpholines (CHEBI:38785) |
| rivaroxaban (CHEBI:68579) is a organochlorine compound (CHEBI:36683) |
| rivaroxaban (CHEBI:68579) is a oxazolidinone (CHEBI:55374) |
| rivaroxaban (CHEBI:68579) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 5-chloro-N-({(5S)-2-oxo-3-[4-(3-oxomorpholin-4-yl)phenyl]-1,3-oxazolidin-5-yl}methyl)thiophene-2-carboxamide |
| INN | Source |
|---|---|
| rivaroxaban | KEGG DRUG |
| Synonyms | Source |
|---|---|
| BAY 59-7939 | ChemIDplus |
| BAY59-7939 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Xarelto | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4182 | DrugCentral |
| D07086 | KEGG DRUG |
| DB06228 | DrugBank |
| EP1685841 | Patent |
| LSM-5499 | LINCS |
| RIV | PDBeChem |
| Rivaroxaban | Wikipedia |
| US2005182055 | Patent |
| US2007026065 | Patent |
| US2009036504 | Patent |
| US2010151011 | Patent |
| US2011034453 | Patent |
| US2011112083 | Patent |
| US2011152266 | Patent |
| US2011288294 | Patent |
| US7816355 | Patent |
| WO2004060887 | Patent |
| WO2005068456 | Patent |
| WO2008140220 | Patent |
| WO2011080341 | Patent |
| WO2012035057 | Patent |
| WO2012051692 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10206739 | Reaxys |
| CAS:366789-02-8 | ChemIDplus |
| Citations |
|---|