EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18ClN3O5S |
| Net Charge | 0 |
| Average Mass | 435.889 |
| Monoisotopic Mass | 435.06557 |
| SMILES | O=C(NC[C@H]1CN(c2ccc(N3CCOCC3=O)cc2)C(=O)O1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H18ClN3O5S/c20-16-6-5-15(29-16)18(25)21-9-14-10-23(19(26)28-14)13-3-1-12(2-4-13)22-7-8-27-11-17(22)24/h1-6,14H,7-11H2,(H,21,25)/t14-/m0/s1 |
| InChIKey | KGFYHTZWPPHNLQ-AWEZNQCLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.21.6 (coagulation factor Xa) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of coagulation factor Xa (EC 3.4.21.6). anti-obesity agent Any substance which is used to reduce or control weight. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anticoagulant An agent that prevents blood clotting. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. hepatoprotective agent Any compound that is able to prevent damage to the liver. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rivaroxaban (CHEBI:68579) has role anti-anaemic agent (CHEBI:75835) |
| rivaroxaban (CHEBI:68579) has role anti-arrhythmia drug (CHEBI:38070) |
| rivaroxaban (CHEBI:68579) has role anti-obesity agent (CHEBI:74518) |
| rivaroxaban (CHEBI:68579) has role anticoagulant (CHEBI:50249) |
| rivaroxaban (CHEBI:68579) has role antineoplastic agent (CHEBI:35610) |
| rivaroxaban (CHEBI:68579) has role antiviral agent (CHEBI:22587) |
| rivaroxaban (CHEBI:68579) has role cardiovascular drug (CHEBI:35554) |
| rivaroxaban (CHEBI:68579) has role EC 3.4.21.6 (coagulation factor Xa) inhibitor (CHEBI:68581) |
| rivaroxaban (CHEBI:68579) has role hepatoprotective agent (CHEBI:62868) |
| rivaroxaban (CHEBI:68579) has role hypoglycemic agent (CHEBI:35526) |
| rivaroxaban (CHEBI:68579) is a aromatic amide (CHEBI:62733) |
| rivaroxaban (CHEBI:68579) is a lactam (CHEBI:24995) |
| rivaroxaban (CHEBI:68579) is a monocarboxylic acid amide (CHEBI:29347) |
| rivaroxaban (CHEBI:68579) is a morpholines (CHEBI:38785) |
| rivaroxaban (CHEBI:68579) is a organochlorine compound (CHEBI:36683) |
| rivaroxaban (CHEBI:68579) is a oxazolidinone (CHEBI:55374) |
| rivaroxaban (CHEBI:68579) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 5-chloro-N-({(5S)-2-oxo-3-[4-(3-oxomorpholin-4-yl)phenyl]-1,3-oxazolidin-5-yl}methyl)thiophene-2-carboxamide |
| INN | Source |
|---|---|
| rivaroxaban | KEGG DRUG |
| Synonyms | Source |
|---|---|
| BAY 59-7939 | ChemIDplus |
| BAY-59-7939 | ChEMBL |
| BAY59-7939 | ChemIDplus |
| JNJ-39039039 | ChEMBL |
| JNJ39039039 | ChEMBL |
| Brand Names | Source |
|---|---|
| Rivaroxaban accord | ChEMBL |
| Rivaroxaban viatris (previously rivaroxaban mylan) | ChEMBL |
| Xarelto | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4182 | DrugCentral |
| D07086 | KEGG DRUG |
| DB06228 | DrugBank |
| EP1685841 | Patent |
| LSM-5499 | LINCS |
| RIV | PDBeChem |
| Rivaroxaban | Wikipedia |
| US2005182055 | Patent |
| US2007026065 | Patent |
| US2009036504 | Patent |
| US2010151011 | Patent |
| US2011034453 | Patent |
| US2011112083 | Patent |
| US2011152266 | Patent |
| US2011288294 | Patent |
| US7816355 | Patent |
| WO2004060887 | Patent |
| WO2005068456 | Patent |
| WO2008140220 | Patent |
| WO2011080341 | Patent |
| WO2012035057 | Patent |
| WO2012051692 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10206739 | Reaxys |
| CAS:366789-02-8 | ChemIDplus |
| Citations |
|---|