EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O4 |
| Net Charge | 0 |
| Average Mass | 146.142 |
| Monoisotopic Mass | 146.05791 |
| SMILES | CC(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C6H10O4/c1-4(2-5(7)8)3-6(9)10/h4H,2-3H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | XJMMNTGIMDZPMU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylglutaric acid (CHEBI:68566) has functional parent glutaric acid (CHEBI:17859) |
| 3-methylglutaric acid (CHEBI:68566) has role metabolite (CHEBI:25212) |
| 3-methylglutaric acid (CHEBI:68566) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| Incoming Relation(s) |
| O-3-methylglutarylcarnitine (CHEBI:70857) has functional parent 3-methylglutaric acid (CHEBI:68566) |
| IUPAC Name |
|---|
| 3-methylpentanedioic acid |
| Synonym | Source |
|---|---|
| β-methylglutaric acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000752 | HMDB |
| LMFA01170117 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1759502 | Reaxys |
| CAS:626-51-7 | ChemIDplus |
| Citations |
|---|