EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H38O2 |
| Net Charge | 0 |
| Average Mass | 298.511 |
| Monoisotopic Mass | 298.28718 |
| SMILES | CCCCCCCCC(C)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C19H38O2/c1-3-4-5-6-9-12-15-18(2)16-13-10-7-8-11-14-17-19(20)21/h18H,3-17H2,1-2H3,(H,20,21) |
| InChIKey | BEOUGZFCUMNGOU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tuberculostearic acid (CHEBI:68565) has functional parent octadecanoic acid (CHEBI:28842) |
| tuberculostearic acid (CHEBI:68565) is a long-chain fatty acid (CHEBI:15904) |
| tuberculostearic acid (CHEBI:68565) is a methyl-branched fatty acid (CHEBI:62499) |
| Incoming Relation(s) |
| PIM2 (CHEBI:68562) has functional parent tuberculostearic acid (CHEBI:68565) |
| Synonyms | Source |
|---|---|
| 10-methyloctadecanoic acid | ChEBI |
| 10-methylstearic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Tuberculostearic acid | Wikipedia |
| C16794 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:542-47-2 | ChemIDplus |
| CAS:542-47-2 | KEGG COMPOUND |