EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28F2N6O4S |
| Net Charge | 0 |
| Average Mass | 522.578 |
| Monoisotopic Mass | 522.18608 |
| SMILES | CCCSc1nc(N[C@@H]2C[C@H]2c2ccc(F)c(F)c2)c2nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C23H28F2N6O4S/c1-2-7-36-23-27-21(26-15-9-12(15)11-3-4-13(24)14(25)8-11)18-22(28-23)31(30-29-18)16-10-17(35-6-5-32)20(34)19(16)33/h3-4,8,12,15-17,19-20,32-34H,2,5-7,9-10H2,1H3,(H,26,27,28)/t12-,15+,16+,17-,19-,20+/m0/s1 |
| InChIKey | OEKWJQXRCDYSHL-FNOIDJSQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | P2Y12 receptor antagonist An antagonist at the P2Y12 receptor |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ticagrelor (CHEBI:68558) has role P2Y12 receptor antagonist (CHEBI:68563) |
| ticagrelor (CHEBI:68558) has role platelet aggregation inhibitor (CHEBI:50427) |
| ticagrelor (CHEBI:68558) is a aryl sulfide (CHEBI:35683) |
| ticagrelor (CHEBI:68558) is a hydroxyether (CHEBI:46789) |
| ticagrelor (CHEBI:68558) is a organofluorine compound (CHEBI:37143) |
| ticagrelor (CHEBI:68558) is a secondary amino compound (CHEBI:50995) |
| ticagrelor (CHEBI:68558) is a triazolopyrimidines (CHEBI:48435) |
| IUPAC Name |
|---|
| (1S,2S,3R,5S)-3-[7-{[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino}-5-(propylsulfanyl)-3H-[1,2,3]triazolo[4,5-d]pyrimidin-3-yl]-5-(2-hydroxyethoxy)cyclopentane-1,2-diol |
| INN | Source |
|---|---|
| ticagrelor | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (1S,2S,3R,5S)-3-(7-((1R,2S)-2-(3,4-Difluorophenyl)cyclopropylamino)-5-(propylthio)-3H-(1,2,3)triazolo(4,5-d)pyrimidin-3-yl)-5-(2-hydroxyethoxy)cyclopentane-1,2-diol | ChemIDplus |
| AZD 6140 | ChemIDplus |
| AZD-6140 | ChemIDplus |
| AZD6140 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Brilinta | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4184 | DrugCentral |
| D09017 | KEGG DRUG |
| HMDB0015702 | HMDB |
| WO2012085665 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15468079 | Reaxys |
| CAS:274693-27-5 | ChemIDplus |
| Citations |
|---|