EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO2 |
| Net Charge | 0 |
| Average Mass | 139.154 |
| Monoisotopic Mass | 139.06333 |
| SMILES | Cc1c(O)c(=O)ccn1C |
| InChI | InChI=1S/C7H9NO2/c1-5-7(10)6(9)3-4-8(5)2/h3-4,10H,1-2H3 |
| InChIKey | TZXKOCQBRNJULO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | |
| Application: | protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deferiprone (CHEBI:68554) has role iron chelator (CHEBI:38157) |
| deferiprone (CHEBI:68554) has role protective agent (CHEBI:50267) |
| deferiprone (CHEBI:68554) is a 4-pyridones (CHEBI:20485) |
| IUPAC Name |
|---|
| 3-hydroxy-1,2-dimethylpyridin-4(1H)-one |
| INN | Source |
|---|---|
| deferiprone | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,2-Dimethyl-3-hydroxypyrid-4-one | ChemIDplus |
| 3-Hydroxy-1,2-dimethyl-4(1H)-pyridone | ChemIDplus |
| Brand Name | Source |
|---|---|
| Ferriprox | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D07416 | KEGG DRUG |
| Deferiprone | Wikipedia |
| LSM-36972 | LINCS |
| 4188 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1447108 | Reaxys |
| CAS:30652-11-0 | KEGG DRUG |
| CAS:30652-11-0 | ChemIDplus |
| Citations |
|---|