EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO2 |
| Net Charge | 0 |
| Average Mass | 139.154 |
| Monoisotopic Mass | 139.06333 |
| SMILES | Cc1c(O)c(=O)ccn1C |
| InChI | InChI=1S/C7H9NO2/c1-5-7(10)6(9)3-4-8(5)2/h3-4,10H,1-2H3 |
| InChIKey | TZXKOCQBRNJULO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | |
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antiparkinson drug A drug used in the treatment of Parkinson's disease. renoprotective agent Any compound that is able to prevent damage to the kidneys. protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deferiprone (CHEBI:68554) has role anti-anaemic agent (CHEBI:75835) |
| deferiprone (CHEBI:68554) has role anti-HIV agent (CHEBI:64946) |
| deferiprone (CHEBI:68554) has role antiparkinson drug (CHEBI:48407) |
| deferiprone (CHEBI:68554) has role cardiovascular drug (CHEBI:35554) |
| deferiprone (CHEBI:68554) has role iron chelator (CHEBI:38157) |
| deferiprone (CHEBI:68554) has role protective agent (CHEBI:50267) |
| deferiprone (CHEBI:68554) has role renoprotective agent (CHEBI:231911) |
| deferiprone (CHEBI:68554) is a 4-pyridones (CHEBI:20485) |
| IUPAC Name |
|---|
| 3-hydroxy-1,2-dimethylpyridin-4(1H)-one |
| INNs | Source |
|---|---|
| deferiprona | WHO MedNet |
| deferiprone | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,2-Dimethyl-3-hydroxypyrid-4-one | ChemIDplus |
| 3-Hydroxy-1,2-dimethyl-4(1H)-pyridone | ChemIDplus |
| APO-066 | ChEMBL |
| APO-66 | ChEMBL |
| CP-20 | ChEMBL |
| CP20 | ChEMBL |
| Brand Names | Source |
|---|---|
| Deferiprone lipomed | ChEMBL |
| Ferriprox | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4188 | DrugCentral |
| D07416 | KEGG DRUG |
| Deferiprone | Wikipedia |
| LSM-36972 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1447108 | Reaxys |
| CAS:30652-11-0 | ChemIDplus |
| CAS:30652-11-0 | KEGG DRUG |
| Citations |
|---|