EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | O10P3 |
| Net Charge | -4 |
| Average Mass | 252.912 |
| Monoisotopic Mass | 252.87263 |
| SMILES | *OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-] |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triphosphate group(4−) (CHEBI:68550) is a inorganic anionic group (CHEBI:64776) |
| triphosphate group(4−) (CHEBI:68550) is conjugate base of triphosphate group (CHEBI:32959) |
| triphosphate group(4−) (CHEBI:68550) is substituent group from triphosphate(5−) (CHEBI:18036) |
| Incoming Relation(s) |
| triphosphate group (CHEBI:32959) is conjugate acid of triphosphate group(4−) (CHEBI:68550) |
| IUPAC Name |
|---|
| ({[(phosphonatooxy)phosphinato]oxy}phosphinato)oxy |
| Synonym | Source |
|---|---|
| triphosphonatooxy group(4−) | ChEBI |
| UniProt Name | Source |
|---|---|
| triphosphate group | UniProt |