EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8N4O3 |
| Net Charge | 0 |
| Average Mass | 196.166 |
| Monoisotopic Mass | 196.05964 |
| SMILES | Cn1c(=O)nc(=O)c2c1nc(=O)n2C |
| InChI | InChI=1S/C7H8N4O3/c1-10-3-4(8-6(10)13)11(2)7(14)9-5(3)12/h1-2H3,(H,8,13)(H,9,12,14) |
| InChIKey | HMLZLHKHNBLLJD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,7-dimethyluric acid (CHEBI:68531) has functional parent 7,9-dihydro-1H-purine-2,6,8(3H)-trione (CHEBI:17775) |
| 3,7-dimethyluric acid (CHEBI:68531) has role metabolite (CHEBI:25212) |
| 3,7-dimethyluric acid (CHEBI:68531) has role mouse metabolite (CHEBI:75771) |
| 3,7-dimethyluric acid (CHEBI:68531) is a oxopurine (CHEBI:25810) |
| 3,7-dimethyluric acid (CHEBI:68531) is conjugate acid of 3,7-dimethylurate anion (CHEBI:133728) |
| Incoming Relation(s) |
| 3,7-dimethylurate anion (CHEBI:133728) is conjugate base of 3,7-dimethyluric acid (CHEBI:68531) |
| IUPAC Name |
|---|
| 3,7-dimethyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione |
| UniProt Name | Source |
|---|---|
| 3,7-dimethylurate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0001982 | HMDB |
| C16360 | KEGG COMPOUND |
| CPD-12482 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:218966 | Reaxys |
| CAS:13087-49-5 | ChemIDplus |
| CAS:13087-49-5 | KEGG COMPOUND |
| Citations |
|---|