EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N3O3 |
| Net Charge | +1 |
| Average Mass | 214.245 |
| Monoisotopic Mass | 214.11862 |
| SMILES | CCCC[C@H](NC(=O)C[N+]#N)C(=O)OC |
| InChI | InChI=1S/C9H15N3O3/c1-3-4-5-7(9(14)15-2)12-8(13)6-11-10/h7H,3-6H2,1-2H3/p+1/t7-/m0/s1 |
| InChIKey | OZHCMJTXDLRZPF-ZETCQYMHSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 2-diazoacetamidohexonate (CHEBI:6851) has role metabolite (CHEBI:25212) |
| methyl 2-diazoacetamidohexonate (CHEBI:6851) is a diazonium ion (CHEBI:50343) |
| IUPAC Name |
|---|
| 2-{[(2S)-1-methoxy-1-oxohexan-2-yl]amino}-2-oxoethanediazonium |
| Manual Xrefs | Databases |
|---|---|
| C01223 | KEGG COMPOUND |