EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12O4 |
| Net Charge | 0 |
| Average Mass | 172.180 |
| Monoisotopic Mass | 172.07356 |
| SMILES | CCOC(=O)/C=C\C(=O)OCC |
| InChI | InChI=1S/C8H12O4/c1-3-11-7(9)5-6-8(10)12-4-2/h5-6H,3-4H2,1-2H3/b6-5- |
| InChIKey | IEPRKVQEAMIZSS-WAYWQWQTSA-N |
| Roles Classification |
|---|
| Biological Role: | glutathione depleting agent A compound which causes a reduction in the levels of glutathione in cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethyl maleate (CHEBI:68508) has functional parent ethanol (CHEBI:16236) |
| diethyl maleate (CHEBI:68508) has role glutathione depleting agent (CHEBI:68509) |
| diethyl maleate (CHEBI:68508) is a ethyl ester (CHEBI:23990) |
| diethyl maleate (CHEBI:68508) is a maleate ester (CHEBI:35486) |
| IUPAC Name |
|---|
| diethyl (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| 2-butenedioic acid (2Z)-, dimethyl ester | ChemIDplus |
| maleic acid, diethyl ester | NIST Chemistry WebBook |
| Citations |
|---|