EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O4 |
| Net Charge | 0 |
| Average Mass | 168.148 |
| Monoisotopic Mass | 168.04226 |
| SMILES | COc1cccc(C(=O)O)c1O |
| InChI | InChI=1S/C8H8O4/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4,9H,1H3,(H,10,11) |
| InChIKey | AUZQQIPZESHNMG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methoxysalicylic acid (CHEBI:68496) has role metabolite (CHEBI:25212) |
| 3-methoxysalicylic acid (CHEBI:68496) is a methoxysalicylic acid (CHEBI:149777) |
| IUPAC Name |
|---|
| 2-hydroxy-3-methoxybenzoic acid |
| Synonym | Source |
|---|---|
| o-vanillic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2209642 | Reaxys |
| CAS:877-22-5 | ChemIDplus |
| Citations |
|---|